C23H24N4 — CID 142352015
ethene;(2S)-2-(prop-1-en-2-ylamino)-4-(pyridin-2-ylmethyl)-2,3-dihydro-1H-cyclopenta[b]indole-7-carbonitrile (PubChem CID 142352015) has the molecular formula C23H24N4 and a molecular weight of 356.47 g/mol. Its IUPAC name is ethene;(2S)-2-(prop-1-en-2-ylamino)-4-(pyridin-2-ylmethyl)-2,3-dihydro-1H-cyclopenta[b]indole-7-carbonitrile.
| Compound Name | ethene;(2S)-2-(prop-1-en-2-ylamino)-4-(pyridin-2-ylmethyl)-2,3-dihydro-1H-cyclopenta[b]indole-7-carbonitrile |
|---|---|
| PubChem CID | 142352015 |
| Molecular Formula | C23H24N4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | ethene;(2S)-2-(prop-1-en-2-ylamino)-4-(pyridin-2-ylmethyl)-2,3-dihydro-1H-cyclopenta[b]indole-7-carbonitrile |
| SMILES | C=C.C=C(C)N[C@H]1Cc2c(n(Cc3ccccn3)c3ccc(C#N)cc23)C1 |
| InChI | InChI=1S/C21H20N4.C2H4/c1-14(2)24-17-10-19-18-9-15(12-22)6-7-20(18)25(21(19)11-17)13-16-5-3-4-8-23-16;1-2/h3-9,17,24H,1,10-11,13H2,2H3;1-2H2/t17-;/m0./s1 |
| InChIKey | VNOMWRUUKDAVFA-LMOVPXPDSA-N |
| XLogP | 4.35 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|