C28H24N6O4S — CID 59242705
(2R)-7-cyano-2-(dimethylsulfamoylamino)-4-[[2-(1,3-dioxoisoindol-2-yl)-3-pyridinyl]methyl]-2,3-dihydro-1H-cyclopenta[b]indole (PubChem CID 59242705) has the molecular formula C28H24N6O4S and a molecular weight of 540.61 g/mol. Its IUPAC name is (2R)-7-cyano-2-(dimethylsulfamoylamino)-4-[[2-(1,3-dioxoisoindol-2-yl)-3-pyridinyl]methyl]-2,3-dihydro-1H-cyclopenta[b]indole.
| Compound Name | (2R)-7-cyano-2-(dimethylsulfamoylamino)-4-[[2-(1,3-dioxoisoindol-2-yl)-3-pyridinyl]methyl]-2,3-dihydro-1H-cyclopenta[b]indole |
|---|---|
| PubChem CID | 59242705 |
| Molecular Formula | C28H24N6O4S |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | (2R)-7-cyano-2-(dimethylsulfamoylamino)-4-[[2-(1,3-dioxoisoindol-2-yl)-3-pyridinyl]methyl]-2,3-dihydro-1H-cyclopenta[b]indole |
| SMILES | CN(C)S(=O)(=O)N[C@@H]1Cc2c(n(Cc3cccnc3N3C(=O)c4ccccc4C3=O)c3ccc(C#N)cc23)C1 |
| InChI | InChI=1S/C28H24N6O4S/c1-32(2)39(37,38)31-19-13-23-22-12-17(15-29)9-10-24(22)33(25(23)14-19)16-18-6-5-11-30-26(18)34-27(35)20-7-3-4-8-21(20)28(34)36/h3-12,19,31H,13-14,16H2,1-2H3/t19-/m1/s1 |
| InChIKey | ZSPJEGPBSALMHQ-LJQANCHMSA-N |
| XLogP | 2.62 |
| TPSA | 128.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|