C20H20FN3O — CID 161277789
N-[[6-amino-9-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydrocarbazol-3-yl]methylidene]hydroxylamine (PubChem CID 161277789) has the molecular formula C20H20FN3O and a molecular weight of 337.40 g/mol. Its IUPAC name is N-[[6-amino-9-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydrocarbazol-3-yl]methylidene]hydroxylamine.
| Compound Name | N-[[6-amino-9-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydrocarbazol-3-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 161277789 |
| Molecular Formula | C20H20FN3O |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N-[[6-amino-9-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydrocarbazol-3-yl]methylidene]hydroxylamine |
| SMILES | NC1CCc2c(c3cc(C=NO)ccc3n2Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C20H20FN3O/c21-15-3-1-2-14(8-15)12-24-19-6-4-13(11-23-25)9-17(19)18-10-16(22)5-7-20(18)24/h1-4,6,8-9,11,16,25H,5,7,10,12,22H2 |
| InChIKey | YTANKJRAJQRMOF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|