C21H20FN3O2 — CID 173090714
9-[(3-fluorophenyl)methyl]-6-(hydroxyiminomethyl)-1,2,3,4-tetrahydrocarbazole-1-carboxamide (PubChem CID 173090714) has the molecular formula C21H20FN3O2 and a molecular weight of 365.41 g/mol. Its IUPAC name is 9-[(3-fluorophenyl)methyl]-6-(hydroxyiminomethyl)-1,2,3,4-tetrahydrocarbazole-1-carboxamide.
| Compound Name | 9-[(3-fluorophenyl)methyl]-6-(hydroxyiminomethyl)-1,2,3,4-tetrahydrocarbazole-1-carboxamide |
|---|---|
| PubChem CID | 173090714 |
| Molecular Formula | C21H20FN3O2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 9-[(3-fluorophenyl)methyl]-6-(hydroxyiminomethyl)-1,2,3,4-tetrahydrocarbazole-1-carboxamide |
| SMILES | NC(=O)C1CCCc2c1n(Cc1cccc(F)c1)c1ccc(C=NO)cc21 |
| InChI | InChI=1S/C21H20FN3O2/c22-15-4-1-3-14(9-15)12-25-19-8-7-13(11-24-27)10-18(19)16-5-2-6-17(20(16)25)21(23)26/h1,3-4,7-11,17,27H,2,5-6,12H2,(H2,23,26) |
| InChIKey | IZPQDEDCYORQQU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|