C25H29N3O4 — CID 164781464
9-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-(oxolan-2-ylmethyl)-1,2,3,4-tetrahydrocarbazole-3-carboxamide (PubChem CID 164781464) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 9-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-(oxolan-2-ylmethyl)-1,2,3,4-tetrahydrocarbazole-3-carboxamide.
| Compound Name | 9-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-(oxolan-2-ylmethyl)-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 164781464 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 9-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-(oxolan-2-ylmethyl)-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
| SMILES | O=C(Cn1c2c(c3ccccc31)CC(C(=O)NCC1CCCO1)CC2)NCc1ccco1 |
| InChI | InChI=1S/C25H29N3O4/c29-24(26-14-18-5-3-11-31-18)16-28-22-8-2-1-7-20(22)21-13-17(9-10-23(21)28)25(30)27-15-19-6-4-12-32-19/h1-3,5,7-8,11,17,19H,4,6,9-10,12-16H2,(H,26,29)(H,27,30) |
| InChIKey | IHVKAFZKOBJMPQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|