C14H22O3 — CID 164781575
(1R,4aR,7R,8aR)-7-acetyl-8a-hydroxy-1,4a-dimethyl-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one (PubChem CID 164781575) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (1R,4aR,7R,8aR)-7-acetyl-8a-hydroxy-1,4a-dimethyl-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one.
| Compound Name | (1R,4aR,7R,8aR)-7-acetyl-8a-hydroxy-1,4a-dimethyl-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 164781575 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (1R,4aR,7R,8aR)-7-acetyl-8a-hydroxy-1,4a-dimethyl-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one |
| SMILES | CC(=O)[C@@H]1CC[C@]2(C)CCC(=O)[C@H](C)[C@]2(O)C1 |
| InChI | InChI=1S/C14H22O3/c1-9-12(16)5-7-13(3)6-4-11(10(2)15)8-14(9,13)17/h9,11,17H,4-8H2,1-3H3/t9-,11+,13+,14+/m0/s1 |
| InChIKey | VMRBALAVPGEUPS-RMIQQSQVSA-N |
| XLogP | 2.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |