C21H37NO3 — CID 164781611
(1R,4aR,7S,8aR)-8a-hydroxy-1,4a-dimethyl-7-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one (PubChem CID 164781611) has the molecular formula C21H37NO3 and a molecular weight of 351.53 g/mol. Its IUPAC name is (1R,4aR,7S,8aR)-8a-hydroxy-1,4a-dimethyl-7-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one.
| Compound Name | (1R,4aR,7S,8aR)-8a-hydroxy-1,4a-dimethyl-7-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 164781611 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | (1R,4aR,7S,8aR)-8a-hydroxy-1,4a-dimethyl-7-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one |
| SMILES | C[C@H]1C(=O)CC[C@@]2(C)CC[C@H](ON3C(C)(C)CCCC3(C)C)C[C@@]12O |
| InChI | InChI=1S/C21H37NO3/c1-15-17(23)9-13-20(6)12-8-16(14-21(15,20)24)25-22-18(2,3)10-7-11-19(22,4)5/h15-16,24H,7-14H2,1-6H3/t15-,16-,20+,21+/m0/s1 |
| InChIKey | GXUKCYUBOXHSIK-LVNJIZSUSA-N |
| XLogP | 4.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |