C18H32N4O — CID 158059286
1-cyclohexyloxy-2,2,6,6-tetramethylpiperidine;1,3,5-triazine (PubChem CID 158059286) has the molecular formula C18H32N4O and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-cyclohexyloxy-2,2,6,6-tetramethylpiperidine;1,3,5-triazine.
| Compound Name | 1-cyclohexyloxy-2,2,6,6-tetramethylpiperidine;1,3,5-triazine |
|---|---|
| PubChem CID | 158059286 |
| Molecular Formula | C18H32N4O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | 1-cyclohexyloxy-2,2,6,6-tetramethylpiperidine;1,3,5-triazine |
| SMILES | CC1(C)CCCC(C)(C)N1OC1CCCCC1.c1ncncn1 |
| InChI | InChI=1S/C15H29NO.C3H3N3/c1-14(2)11-8-12-15(3,4)16(14)17-13-9-6-5-7-10-13;1-4-2-6-3-5-1/h13H,5-12H2,1-4H3;1-3H |
| InChIKey | FKLKAKLJFWKMTI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |