C38H58N2O6-2 — CID 19892366
2,4-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,3-dicarboxylate (PubChem CID 19892366) has the molecular formula C38H58N2O6-2 and a molecular weight of 638.89 g/mol. Its IUPAC name is 2,4-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,3-dicarboxylate.
| Compound Name | 2,4-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 19892366 |
| Molecular Formula | C38H58N2O6-2 |
| Molecular Weight | 638.89 g/mol |
| Exact Mass | 638.43 |
| IUPAC Name | 2,4-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,3-dicarboxylate |
| SMILES | CC1(C)CC(c2ccc(C(=O)[O-])c(C3CC(C)(C)N(OC4CCCCC4)C(C)(C)C3)c2C(=O)[O-])CC(C)(C)N1OC1CCCCC1 |
| InChI | InChI=1S/C38H60N2O6/c1-35(2)21-25(22-36(3,4)39(35)45-27-15-11-9-12-16-27)29-19-20-30(33(41)42)31(32(29)34(43)44)26-23-37(5,6)40(38(7,8)24-26)46-28-17-13-10-14-18-28/h19-20,25-28H,9-18,21-24H2,1-8H3,(H,41,42)(H,43,44)/p-2 |
| InChIKey | SQIZWAXFVRSUGV-UHFFFAOYSA-L |
| XLogP | 6.42 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.89 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |