C19H36N2O2 — CID 22044437
N-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butan-1-imine oxide (PubChem CID 22044437) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is N-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butan-1-imine oxide.
| Compound Name | N-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butan-1-imine oxide |
|---|---|
| PubChem CID | 22044437 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | N-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butan-1-imine oxide |
| SMILES | CCC/C=[N+](\[O-])C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C19H36N2O2/c1-6-7-13-20(22)16-14-18(2,3)21(19(4,5)15-16)23-17-11-9-8-10-12-17/h13,16-17H,6-12,14-15H2,1-5H3/b20-13- |
| InChIKey | XBAACWOFBUOVCB-MOSHPQCFSA-N |
| XLogP | 4.65 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|