C45H54OS — CID 164782084
2-[3,5-bis(3,5-ditert-butylphenyl)phenyl]-4-(2-methylphenyl)thiophen-3-ol (PubChem CID 164782084) has the molecular formula C45H54OS and a molecular weight of 642.99 g/mol. Its IUPAC name is 2-[3,5-bis(3,5-ditert-butylphenyl)phenyl]-4-(2-methylphenyl)thiophen-3-ol.
| Compound Name | 2-[3,5-bis(3,5-ditert-butylphenyl)phenyl]-4-(2-methylphenyl)thiophen-3-ol |
|---|---|
| PubChem CID | 164782084 |
| Molecular Formula | C45H54OS |
| Molecular Weight | 642.99 g/mol |
| Exact Mass | 642.39 |
| IUPAC Name | 2-[3,5-bis(3,5-ditert-butylphenyl)phenyl]-4-(2-methylphenyl)thiophen-3-ol |
| SMILES | Cc1ccccc1-c1csc(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2)c1O |
| InChI | InChI=1S/C45H54OS/c1-28-16-14-15-17-38(28)39-27-47-41(40(39)46)33-19-29(31-21-34(42(2,3)4)25-35(22-31)43(5,6)7)18-30(20-33)32-23-36(44(8,9)10)26-37(24-32)45(11,12)13/h14-27,46H,1-13H3 |
| InChIKey | JTJWGWVZBFQYMU-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.99 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|