C44H51NO2S — CID 172627159
4-(3,6-ditert-butylcarbazol-9-yl)-2-[5-(3,5-ditert-butylphenyl)-2-hydroxyphenyl]thiophen-3-ol (PubChem CID 172627159) has the molecular formula C44H51NO2S and a molecular weight of 657.96 g/mol. Its IUPAC name is 4-(3,6-ditert-butylcarbazol-9-yl)-2-[5-(3,5-ditert-butylphenyl)-2-hydroxyphenyl]thiophen-3-ol.
| Compound Name | 4-(3,6-ditert-butylcarbazol-9-yl)-2-[5-(3,5-ditert-butylphenyl)-2-hydroxyphenyl]thiophen-3-ol |
|---|---|
| PubChem CID | 172627159 |
| Molecular Formula | C44H51NO2S |
| Molecular Weight | 657.96 g/mol |
| Exact Mass | 657.36 |
| IUPAC Name | 4-(3,6-ditert-butylcarbazol-9-yl)-2-[5-(3,5-ditert-butylphenyl)-2-hydroxyphenyl]thiophen-3-ol |
| SMILES | CC(C)(C)c1cc(-c2ccc(O)c(-c3scc(-n4c5ccc(C(C)(C)C)cc5c5cc(C(C)(C)C)ccc54)c3O)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C44H51NO2S/c1-41(2,3)28-14-16-35-32(23-28)33-24-29(42(4,5)6)15-17-36(33)45(35)37-25-48-40(39(37)47)34-21-26(13-18-38(34)46)27-19-30(43(7,8)9)22-31(20-27)44(10,11)12/h13-25,46-47H,1-12H3 |
| InChIKey | OBBKISRLRBFABR-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.96 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|