C41H41F4IrN2O2- — CID 164783373
1-(4-tert-butyl-1H-anthracen-1-id-2-yl)-5,6,7,8-tetrafluoroisoquinoline-4-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 164783373) has the molecular formula C41H41F4IrN2O2- and a molecular weight of 862.00 g/mol. Its IUPAC name is 1-(4-tert-butyl-1H-anthracen-1-id-2-yl)-5,6,7,8-tetrafluoroisoquinoline-4-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 1-(4-tert-butyl-1H-anthracen-1-id-2-yl)-5,6,7,8-tetrafluoroisoquinoline-4-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 164783373 |
| Molecular Formula | C41H41F4IrN2O2- |
| Molecular Weight | 862.00 g/mol |
| Exact Mass | 862.27 |
| IUPAC Name | 1-(4-tert-butyl-1H-anthracen-1-id-2-yl)-5,6,7,8-tetrafluoroisoquinoline-4-carbonitrile;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CC(C)(C)c1cc(-c2ncc(C#N)c3c(F)c(F)c(F)c(F)c23)[c-]c2cc3ccccc3cc12.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C28H17F4N2.C13H24O2.Ir/c1-28(2,3)20-11-17(9-16-8-14-6-4-5-7-15(14)10-19(16)20)27-22-21(18(12-33)13-34-27)23(29)25(31)26(32)24(22)30;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-8,10-11,13H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | SXBUMFNOHYVXNC-DZTQYQPZSA-N |
| XLogP | 11.60 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.00 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|