C33H29IrN3O2-2 — CID 164796272
CID 164796272 (PubChem CID 164796272) has the molecular formula C33H29IrN3O2-2 and a molecular weight of 691.83 g/mol.
| Compound Name | CID 164796272 |
|---|---|
| PubChem CID | 164796272 |
| Molecular Formula | C33H29IrN3O2-2 |
| Molecular Weight | 691.83 g/mol |
| Exact Mass | 692.19 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(/C)O.CC(C)N1[CH-]N(c2[c-]c3c4ccccc4n4c5ccccc5c(c2)c34)c2ccccc21.[Ir] |
| InChI | InChI=1S/C28H21N3.C5H8O2.Ir/c1-18(2)29-17-30(27-14-8-7-13-26(27)29)19-15-22-20-9-3-5-11-24(20)31-25-12-6-4-10-21(25)23(16-19)28(22)31;1-4(6)3-5(2)7;/h3-15,17-18H,1-2H3;3,6H,1-2H3;/q-2;;/b;4-3-; |
| InChIKey | YPYHNSGDWAVMMW-LWFKIUJUSA-N |
| XLogP | 8.16 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.83 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|