C24H25IrN2O2- — CID 158994830
5-tert-butyl-1H-indazolo[2,3-a]quinolin-1-ide;4-hydroxypent-3-en-2-one;iridium (PubChem CID 158994830) has the molecular formula C24H25IrN2O2- and a molecular weight of 565.69 g/mol. Its IUPAC name is 5-tert-butyl-1H-indazolo[2,3-a]quinolin-1-ide;4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 5-tert-butyl-1H-indazolo[2,3-a]quinolin-1-ide;4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 158994830 |
| Molecular Formula | C24H25IrN2O2- |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 5-tert-butyl-1H-indazolo[2,3-a]quinolin-1-ide;4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)C=C(C)O.CC(C)(C)c1cc2c3ccccc3nn2c2[c-]cccc12.[Ir] |
| InChI | InChI=1S/C19H17N2.C5H8O2.Ir/c1-19(2,3)15-12-18-14-9-4-6-10-16(14)20-21(18)17-11-7-5-8-13(15)17;1-4(6)3-5(2)7;/h4-10,12H,1-3H3;3,6H,1-2H3;/q-1;; |
| InChIKey | PDJMDBQIAMAHTG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|