About 5,8-ditert-butylindazolo[2,3-a]quinoline
5,8-ditert-butylindazolo[2,3-a]quinoline (PubChem CID 140607242) has the molecular formula C23H26N2
and a molecular weight of 330.48 g/mol. Its IUPAC name is 5,8-ditert-butylindazolo[2,3-a]quinoline.
Molecular Properties
| Compound Name | 5,8-ditert-butylindazolo[2,3-a]quinoline |
| PubChem CID | 140607242 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 5,8-ditert-butylindazolo[2,3-a]quinoline |
| SMILES | CC(C)(C)c1ccc2nn3c4ccccc4c(C(C)(C)C)cc3c2c1 |
| InChI | InChI=1S/C23H26N2/c1-22(2,3)15-11-12-19-17(13-15)21-14-18(23(4,5)6)16-9-7-8-10-20(16)25(21)24-19/h7-14H,1-6H3 |
| InChIKey | LJZLTFVELOZYAQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,8-ditert-butylindazolo[2,3-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-ditert-butylindazolo[2,3-a]quinoline?
The IUPAC name of 5,8-ditert-butylindazolo[2,3-a]quinoline (CID 140607242) is 5,8-ditert-butylindazolo[2,3-a]quinoline.
What is the SMILES notation for 5,8-ditert-butylindazolo[2,3-a]quinoline?
The canonical SMILES for 5,8-ditert-butylindazolo[2,3-a]quinoline is CC(C)(C)c1ccc2nn3c4ccccc4c(C(C)(C)C)cc3c2c1.
What is the InChIKey of 5,8-ditert-butylindazolo[2,3-a]quinoline?
The InChIKey is LJZLTFVELOZYAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2/c1-22(2,3)15-11-12-19-17(13-15)21-14-18(23(4,5)6)16-9-7-8-10-20(16)25(21)24-19/h7-14H,1-6H3.
What are the key properties of 5,8-ditert-butylindazolo[2,3-a]quinoline?
5,8-ditert-butylindazolo[2,3-a]quinoline has a molecular weight of 330.48 g/mol, XLogP of 6.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-ditert-butylindazolo[2,3-a]quinoline is sourced from PubChem (CID 140607242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).