C41H27IrN3O-2 — CID 164802669
iridium;5-methyl-2-phenylpyridine;14-(3-pyridin-2-ylbenzene-4-id-1-yl)-9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (PubChem CID 164802669) has the molecular formula C41H27IrN3O-2 and a molecular weight of 769.90 g/mol. Its IUPAC name is iridium;5-methyl-2-phenylpyridine;14-(3-pyridin-2-ylbenzene-4-id-1-yl)-9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene.
| Compound Name | iridium;5-methyl-2-phenylpyridine;14-(3-pyridin-2-ylbenzene-4-id-1-yl)-9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 164802669 |
| Molecular Formula | C41H27IrN3O-2 |
| Molecular Weight | 769.90 g/mol |
| Exact Mass | 770.18 |
| IUPAC Name | iridium;5-methyl-2-phenylpyridine;14-(3-pyridin-2-ylbenzene-4-id-1-yl)-9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.[Ir].[c-]1ccc(-n2c3ccccc3c3c4c(ccc32)oc2ccccc24)cc1-c1ccccn1 |
| InChI | InChI=1S/C29H17N2O.C12H10N.Ir/c1-3-13-24-21(10-1)28-25(15-16-27-29(28)22-11-2-4-14-26(22)32-27)31(24)20-9-7-8-19(18-20)23-12-5-6-17-30-23;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h1-7,9-18H;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | YMXNKZQJEMUAIS-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.90 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|