C17H15N3 — CID 164805086
3,4,9-tris(trideuteriomethyl)-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7(12),8,10,13,15-octaene (PubChem CID 164805086) has the molecular formula C17H15N3 and a molecular weight of 270.38 g/mol. Its IUPAC name is 3,4,9-tris(trideuteriomethyl)-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7(12),8,10,13,15-octaene.
| Compound Name | 3,4,9-tris(trideuteriomethyl)-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7(12),8,10,13,15-octaene |
|---|---|
| PubChem CID | 164805086 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 3,4,9-tris(trideuteriomethyl)-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7(12),8,10,13,15-octaene |
| SMILES | [2H]C([2H])([2H])c1cnc2c3ccccc3n3c(C([2H])([2H])[2H])c(C([2H])([2H])[2H])nc3c2c1 |
| InChI | InChI=1S/C17H15N3/c1-10-8-14-16(18-9-10)13-6-4-5-7-15(13)20-12(3)11(2)19-17(14)20/h4-9H,1-3H3/i1D3,2D3,3D3 |
| InChIKey | FERNYDJZEGDRIL-GQALSZNTSA-N |
| XLogP | 3.96 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|