C21H13N3O — CID 164805090
4-(trideuteriomethyl)-16-oxa-1,6,24-triazahexacyclo[12.10.0.02,7.08,13.015,23.017,22]tetracosa-2(7),3,5,8,10,12,14,17,19,21,23-undecaene (PubChem CID 164805090) has the molecular formula C21H13N3O and a molecular weight of 326.37 g/mol. Its IUPAC name is 4-(trideuteriomethyl)-16-oxa-1,6,24-triazahexacyclo[12.10.0.02,7.08,13.015,23.017,22]tetracosa-2(7),3,5,8,10,12,14,17,19,21,23-undecaene.
| Compound Name | 4-(trideuteriomethyl)-16-oxa-1,6,24-triazahexacyclo[12.10.0.02,7.08,13.015,23.017,22]tetracosa-2(7),3,5,8,10,12,14,17,19,21,23-undecaene |
|---|---|
| PubChem CID | 164805090 |
| Molecular Formula | C21H13N3O |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4-(trideuteriomethyl)-16-oxa-1,6,24-triazahexacyclo[12.10.0.02,7.08,13.015,23.017,22]tetracosa-2(7),3,5,8,10,12,14,17,19,21,23-undecaene |
| SMILES | [2H]C([2H])([2H])c1cnc2c3ccccc3c3c4oc5ccccc5c4nn3c2c1 |
| InChI | InChI=1S/C21H13N3O/c1-12-10-16-18(22-11-12)13-6-2-3-7-14(13)20-21-19(23-24(16)20)15-8-4-5-9-17(15)25-21/h2-11H,1H3/i1D3 |
| InChIKey | NFESYOAWDLKNRP-FIBGUPNXSA-N |
| XLogP | 5.24 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|