C26H28F3IrN4O2SSe- — CID 164807531
7-(3H-1-benzoselenophen-3-id-2-yl)-4-(trifluoromethyl)-[1,2,5]thiadiazolo[3,4-d]pyridazine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 164807531) has the molecular formula C26H28F3IrN4O2SSe- and a molecular weight of 788.77 g/mol. Its IUPAC name is 7-(3H-1-benzoselenophen-3-id-2-yl)-4-(trifluoromethyl)-[1,2,5]thiadiazolo[3,4-d]pyridazine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 7-(3H-1-benzoselenophen-3-id-2-yl)-4-(trifluoromethyl)-[1,2,5]thiadiazolo[3,4-d]pyridazine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 164807531 |
| Molecular Formula | C26H28F3IrN4O2SSe- |
| Molecular Weight | 788.77 g/mol |
| Exact Mass | 790.07 |
| IUPAC Name | 7-(3H-1-benzoselenophen-3-id-2-yl)-4-(trifluoromethyl)-[1,2,5]thiadiazolo[3,4-d]pyridazine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.FC(F)(F)c1nnc(-c2[c-]c3ccccc3[se]2)c2nsnc12.[Ir] |
| InChI | InChI=1S/C13H4F3N4SSe.C13H24O2.Ir/c14-13(15,16)12-11-10(19-21-20-11)9(17-18-12)8-5-6-3-1-2-4-7(6)22-8;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-4H;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | MWBBVFYKKCHLBP-DZTQYQPZSA-N |
| XLogP | 7.04 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.77 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|