C34H34F3IrN2O2Se- — CID 166011200
4-(3H-1-benzoselenophen-3-id-2-yl)-2,5,6,7,8,9-hexadeuterio-10-(trifluoromethyl)benzo[g]quinazoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 166011200) has the molecular formula C34H34F3IrN2O2Se- and a molecular weight of 836.87 g/mol. Its IUPAC name is 4-(3H-1-benzoselenophen-3-id-2-yl)-2,5,6,7,8,9-hexadeuterio-10-(trifluoromethyl)benzo[g]quinazoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 4-(3H-1-benzoselenophen-3-id-2-yl)-2,5,6,7,8,9-hexadeuterio-10-(trifluoromethyl)benzo[g]quinazoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 166011200 |
| Molecular Formula | C34H34F3IrN2O2Se- |
| Molecular Weight | 836.87 g/mol |
| Exact Mass | 838.17 |
| IUPAC Name | 4-(3H-1-benzoselenophen-3-id-2-yl)-2,5,6,7,8,9-hexadeuterio-10-(trifluoromethyl)benzo[g]quinazoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[2H]c1nc(-c2[c-]c3ccccc3[se]2)c2c([2H])c3c([2H])c([2H])c([2H])c([2H])c3c(C(F)(F)F)c2n1.[Ir] |
| InChI | InChI=1S/C21H10F3N2Se.C13H24O2.Ir/c22-21(23,24)18-14-7-3-1-5-12(14)9-15-19(25-11-26-20(15)18)17-10-13-6-2-4-8-16(13)27-17;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-9,11H;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;/i1D,3D,5D,7D,9D,11D;; |
| InChIKey | OOHCBJILODXEAL-PSSFZBIUSA-N |
| XLogP | 9.35 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.87 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|