C35H38ClN3O3 — CID 164809291
5-[(2-chlorophenyl)-[6-(3,5-ditert-butylphenyl)-1H-indol-3-yl]methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 164809291) has the molecular formula C35H38ClN3O3 and a molecular weight of 584.16 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)-[6-(3,5-ditert-butylphenyl)-1H-indol-3-yl]methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2-chlorophenyl)-[6-(3,5-ditert-butylphenyl)-1H-indol-3-yl]methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 164809291 |
| Molecular Formula | C35H38ClN3O3 |
| Molecular Weight | 584.16 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | 5-[(2-chlorophenyl)-[6-(3,5-ditert-butylphenyl)-1H-indol-3-yl]methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(C(c2ccccc2Cl)c2c[nH]c3cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)ccc23)C(=O)N(C)C1=O |
| InChI | InChI=1S/C35H38ClN3O3/c1-34(2,3)22-15-21(16-23(18-22)35(4,5)6)20-13-14-24-26(19-37-28(24)17-20)29(25-11-9-10-12-27(25)36)30-31(40)38(7)33(42)39(8)32(30)41/h9-19,29-30,37H,1-8H3 |
| InChIKey | SPZGTICZDIXSRC-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.16 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|