C26H30FO12P — CID 164809873
[(2S,3R,5S)-3,5-diacetyloxy-2-diphenoxyphosphoryloxy-6-[(1S)-1-fluoro-2-methoxyethyl]oxan-4-yl] acetate (PubChem CID 164809873) has the molecular formula C26H30FO12P and a molecular weight of 584.49 g/mol. Its IUPAC name is [(2S,3R,5S)-3,5-diacetyloxy-2-diphenoxyphosphoryloxy-6-[(1S)-1-fluoro-2-methoxyethyl]oxan-4-yl] acetate.
| Compound Name | [(2S,3R,5S)-3,5-diacetyloxy-2-diphenoxyphosphoryloxy-6-[(1S)-1-fluoro-2-methoxyethyl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 164809873 |
| Molecular Formula | C26H30FO12P |
| Molecular Weight | 584.49 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | [(2S,3R,5S)-3,5-diacetyloxy-2-diphenoxyphosphoryloxy-6-[(1S)-1-fluoro-2-methoxyethyl]oxan-4-yl] acetate |
| SMILES | COC[C@H](F)C1O[C@@H](OP(=O)(Oc2ccccc2)Oc2ccccc2)[C@H](OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H30FO12P/c1-16(28)33-23-22(21(27)15-32-4)36-26(25(35-18(3)30)24(23)34-17(2)29)39-40(31,37-19-11-7-5-8-12-19)38-20-13-9-6-10-14-20/h5-14,21-26H,15H2,1-4H3/t21-,22?,23+,24?,25+,26-/m0/s1 |
| InChIKey | GXGDFGPXQCGWNA-BQNSJSHXSA-N |
| XLogP | 3.77 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|