C10H22O2Sc — CID 164810303
2,4-dimethyloctane-3,5-diol;scandium (PubChem CID 164810303) has the molecular formula C10H22O2Sc and a molecular weight of 219.24 g/mol. Its IUPAC name is 2,4-dimethyloctane-3,5-diol;scandium.
| Compound Name | 2,4-dimethyloctane-3,5-diol;scandium |
|---|---|
| PubChem CID | 164810303 |
| Molecular Formula | C10H22O2Sc |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 2,4-dimethyloctane-3,5-diol;scandium |
| SMILES | CCCC(O)C(C)C(O)C(C)C.[Sc] |
| InChI | InChI=1S/C10H22O2.Sc/c1-5-6-9(11)8(4)10(12)7(2)3;/h7-12H,5-6H2,1-4H3; |
| InChIKey | UOQGUHXIXINADZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |