C53H53N3 — CID 164818505
4-[4-[3-[4-[4,6-bis(4-tert-butylphenyl)pyrimidin-2-yl]phenyl]-1-adamantyl]phenyl]benzonitrile (PubChem CID 164818505) has the molecular formula C53H53N3 and a molecular weight of 732.03 g/mol. Its IUPAC name is 4-[4-[3-[4-[4,6-bis(4-tert-butylphenyl)pyrimidin-2-yl]phenyl]-1-adamantyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[3-[4-[4,6-bis(4-tert-butylphenyl)pyrimidin-2-yl]phenyl]-1-adamantyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 164818505 |
| Molecular Formula | C53H53N3 |
| Molecular Weight | 732.03 g/mol |
| Exact Mass | 731.42 |
| IUPAC Name | 4-[4-[3-[4-[4,6-bis(4-tert-butylphenyl)pyrimidin-2-yl]phenyl]-1-adamantyl]phenyl]benzonitrile |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(C45CC6CC(CC(c7ccc(-c8ccc(C#N)cc8)cc7)(C6)C4)C5)cc3)n2)cc1 |
| InChI | InChI=1S/C53H53N3/c1-50(2,3)43-19-13-40(14-20-43)47-28-48(41-15-21-44(22-16-41)51(4,5)6)56-49(55-47)42-17-25-46(26-18-42)53-31-36-27-37(32-53)30-52(29-36,34-53)45-23-11-39(12-24-45)38-9-7-35(33-54)8-10-38/h7-26,28,36-37H,27,29-32,34H2,1-6H3 |
| InChIKey | OFOXYTNUIDTNLH-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.03 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |