C61H46N4 — CID 164818758
4-[3-[3-[7-(6-naphthalen-2-yl-2-phenylpyrimidin-4-yl)-9-phenylcarbazol-2-yl]-1-adamantyl]phenyl]benzonitrile (PubChem CID 164818758) has the molecular formula C61H46N4 and a molecular weight of 835.07 g/mol. Its IUPAC name is 4-[3-[3-[7-(6-naphthalen-2-yl-2-phenylpyrimidin-4-yl)-9-phenylcarbazol-2-yl]-1-adamantyl]phenyl]benzonitrile.
| Compound Name | 4-[3-[3-[7-(6-naphthalen-2-yl-2-phenylpyrimidin-4-yl)-9-phenylcarbazol-2-yl]-1-adamantyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 164818758 |
| Molecular Formula | C61H46N4 |
| Molecular Weight | 835.07 g/mol |
| Exact Mass | 834.37 |
| IUPAC Name | 4-[3-[3-[7-(6-naphthalen-2-yl-2-phenylpyrimidin-4-yl)-9-phenylcarbazol-2-yl]-1-adamantyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cccc(C34CC5CC(C3)CC(c3ccc6c7ccc(-c8cc(-c9ccc%10ccccc%10c9)nc(-c9ccccc9)n8)cc7n(-c7ccccc7)c6c3)(C5)C4)c2)cc1 |
| InChI | InChI=1S/C61H46N4/c62-38-40-18-20-44(21-19-40)47-14-9-15-50(30-47)60-34-41-28-42(35-60)37-61(36-41,39-60)51-25-27-54-53-26-24-49(31-57(53)65(58(54)32-51)52-16-5-2-6-17-52)56-33-55(63-59(64-56)45-11-3-1-4-12-45)48-23-22-43-10-7-8-13-46(43)29-48/h1-27,29-33,41-42H,28,34-37,39H2 |
| InChIKey | UINNXPOEWUXFPQ-UHFFFAOYSA-N |
| XLogP | 15.06 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.07 |
| LogP ≤ 5 | 15.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |