C20H21N — CID 164818788
5-tert-butyl-2-isocyano-9,9-dimethylfluorene (PubChem CID 164818788) has the molecular formula C20H21N and a molecular weight of 275.39 g/mol. Its IUPAC name is 5-tert-butyl-2-isocyano-9,9-dimethylfluorene.
| Compound Name | 5-tert-butyl-2-isocyano-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 164818788 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 5-tert-butyl-2-isocyano-9,9-dimethylfluorene |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)(C)c1cccc(C(C)(C)C)c1-2 |
| InChI | InChI=1S/C20H21N/c1-19(2,3)15-8-7-9-16-18(15)14-11-10-13(21-6)12-17(14)20(16,4)5/h7-12H,1-5H3 |
| InChIKey | RZMNJNUKMGDVIW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|