C19H23N — CID 86052658
1,3-ditert-butyl-5-isocyanoazulene (PubChem CID 86052658) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-isocyanoazulene.
| Compound Name | 1,3-ditert-butyl-5-isocyanoazulene |
|---|---|
| PubChem CID | 86052658 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1,3-ditert-butyl-5-isocyanoazulene |
| SMILES | [C-]#[N+]c1cccc2c(C(C)(C)C)cc(C(C)(C)C)c-2c1 |
| InChI | InChI=1S/C19H23N/c1-18(2,3)16-12-17(19(4,5)6)15-11-13(20-7)9-8-10-14(15)16/h8-12H,1-6H3 |
| InChIKey | PTHRBMXELZQIJN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|