C24H22N4 — CID 164819251
2-tert-butyl-4-(4-phenylphenyl)-6-pyridin-3-yl-1,3,5-triazine (PubChem CID 164819251) has the molecular formula C24H22N4 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-tert-butyl-4-(4-phenylphenyl)-6-pyridin-3-yl-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-(4-phenylphenyl)-6-pyridin-3-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 164819251 |
| Molecular Formula | C24H22N4 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-tert-butyl-4-(4-phenylphenyl)-6-pyridin-3-yl-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccc(-c3ccccc3)cc2)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C24H22N4/c1-24(2,3)23-27-21(26-22(28-23)20-10-7-15-25-16-20)19-13-11-18(12-14-19)17-8-5-4-6-9-17/h4-16H,1-3H3 |
| InChIKey | QYVSDLLNVRMCDO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |