C33H31F2N5O6 — CID 164827448
(2R,3R,4S,5R)-2-(6-amino-2-phenylpurin-9-yl)-5-[[3-[2-[(1S,3R)-2,2-difluoro-1,3-dihydroxy-3H-inden-1-yl]ethyl]phenoxy]methyl]oxolane-3,4-diol (PubChem CID 164827448) has the molecular formula C33H31F2N5O6 and a molecular weight of 631.64 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-2-phenylpurin-9-yl)-5-[[3-[2-[(1S,3R)-2,2-difluoro-1,3-dihydroxy-3H-inden-1-yl]ethyl]phenoxy]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-2-phenylpurin-9-yl)-5-[[3-[2-[(1S,3R)-2,2-difluoro-1,3-dihydroxy-3H-inden-1-yl]ethyl]phenoxy]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 164827448 |
| Molecular Formula | C33H31F2N5O6 |
| Molecular Weight | 631.64 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-2-phenylpurin-9-yl)-5-[[3-[2-[(1S,3R)-2,2-difluoro-1,3-dihydroxy-3H-inden-1-yl]ethyl]phenoxy]methyl]oxolane-3,4-diol |
| SMILES | Nc1nc(-c2ccccc2)nc2c1ncn2[C@@H]1O[C@H](COc2cccc(CC[C@]3(O)c4ccccc4[C@@H](O)C3(F)F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C33H31F2N5O6/c34-33(35)27(43)21-11-4-5-12-22(21)32(33,44)14-13-18-7-6-10-20(15-18)45-16-23-25(41)26(42)31(46-23)40-17-37-24-28(36)38-29(39-30(24)40)19-8-2-1-3-9-19/h1-12,15,17,23,25-27,31,41-44H,13-14,16H2,(H2,36,38,39)/t23-,25-,26-,27-,31-,32+/m1/s1 |
| InChIKey | YWQGVIVCBSGCQN-IOYYRQNBSA-N |
| XLogP | 3.28 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.64 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |