C58H54N4O2 — CID 164833967
6-tert-butyl-3-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-7-(2,6-diphenylphenyl)-5H-imidazo[5,1-b][1,3]oxazol-6-ium-5-ide (PubChem CID 164833967) has the molecular formula C58H54N4O2 and a molecular weight of 839.10 g/mol. Its IUPAC name is 6-tert-butyl-3-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-7-(2,6-diphenylphenyl)-5H-imidazo[5,1-b][1,3]oxazol-6-ium-5-ide.
| Compound Name | 6-tert-butyl-3-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-7-(2,6-diphenylphenyl)-5H-imidazo[5,1-b][1,3]oxazol-6-ium-5-ide |
|---|---|
| PubChem CID | 164833967 |
| Molecular Formula | C58H54N4O2 |
| Molecular Weight | 839.10 g/mol |
| Exact Mass | 838.42 |
| IUPAC Name | 6-tert-butyl-3-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-7-(2,6-diphenylphenyl)-5H-imidazo[5,1-b][1,3]oxazol-6-ium-5-ide |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccc(C(C)(C)C)cc3c3ccc(Oc4cccc(-c5coc6c(-c7c(-c8ccccc8)cccc7-c7ccccc7)[n+](C(C)(C)C)[c-]n56)c4)cc32)c1 |
| InChI | InChI=1S/C58H54N4O2/c1-56(2,3)41-26-29-49-48(33-41)47-28-27-44(35-50(47)62(49)52-34-42(30-31-59-52)57(4,5)6)64-43-23-16-22-40(32-43)51-36-63-55-54(61(37-60(51)55)58(7,8)9)53-45(38-18-12-10-13-19-38)24-17-25-46(53)39-20-14-11-15-21-39/h10-36H,1-9H3 |
| InChIKey | NZWFHPZQDAYOCO-UHFFFAOYSA-N |
| XLogP | 14.92 |
| TPSA | 48.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.10 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|