C10H14O3 — CID 164838316
1,6,8-trioxaspiro[6.6]trideca-3,10-diene (PubChem CID 164838316) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1,6,8-trioxaspiro[6.6]trideca-3,10-diene.
| Compound Name | 1,6,8-trioxaspiro[6.6]trideca-3,10-diene |
|---|---|
| PubChem CID | 164838316 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1,6,8-trioxaspiro[6.6]trideca-3,10-diene |
| SMILES | C1=CCOC2(CC1)OCC=CCO2 |
| InChI | InChI=1S/C10H14O3/c1-2-6-10(11-7-3-1)12-8-4-5-9-13-10/h1,3-5H,2,6-9H2 |
| InChIKey | YXGSJNQAHCBRCA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|