C12H16O — CID 101348707
(4aR,6aS,10aR)-4a,5,6,6a,9,10-hexahydro-2H-indeno[7a,1-b]pyran (PubChem CID 101348707) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (4aR,6aS,10aR)-4a,5,6,6a,9,10-hexahydro-2H-indeno[7a,1-b]pyran.
| Compound Name | (4aR,6aS,10aR)-4a,5,6,6a,9,10-hexahydro-2H-indeno[7a,1-b]pyran |
|---|---|
| PubChem CID | 101348707 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (4aR,6aS,10aR)-4a,5,6,6a,9,10-hexahydro-2H-indeno[7a,1-b]pyran |
| SMILES | C1=C[C@@H]2CC[C@@H]3C=CCO[C@]23CC1 |
| InChI | InChI=1S/C12H16O/c1-2-8-12-10(4-1)6-7-11(12)5-3-9-13-12/h1,3-5,10-11H,2,6-9H2/t10-,11+,12-/m1/s1 |
| InChIKey | CBSXMWHXDDFIFH-GRYCIOLGSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|