C23H11BrN2 — CID 164839418
15-bromo-19-isocyano-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene (PubChem CID 164839418) has the molecular formula C23H11BrN2 and a molecular weight of 395.26 g/mol. Its IUPAC name is 15-bromo-19-isocyano-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene.
| Compound Name | 15-bromo-19-isocyano-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene |
|---|---|
| PubChem CID | 164839418 |
| Molecular Formula | C23H11BrN2 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 15-bromo-19-isocyano-1-azahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2,4,6,8(22),9,11,13,15,17,19,21(23)-undecaene |
| SMILES | [C-]#[N+]c1cc2cc(Br)cc3c4cccc5c6ccccc6n(c(c1)c23)c45 |
| InChI | InChI=1S/C23H11BrN2/c1-25-15-10-13-9-14(24)11-19-18-7-4-6-17-16-5-2-3-8-20(16)26(23(17)18)21(12-15)22(13)19/h2-12H |
| InChIKey | WPFZRQBWELZNBC-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 8.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|