C14H27N2O3P — CID 164843745
N'-[[trimethoxy(2-phenylethyl)-λ5-phosphanyl]methyl]ethane-1,2-diamine (PubChem CID 164843745) has the molecular formula C14H27N2O3P and a molecular weight of 302.35 g/mol. Its IUPAC name is N'-[[trimethoxy(2-phenylethyl)-λ5-phosphanyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-[[trimethoxy(2-phenylethyl)-λ5-phosphanyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 164843745 |
| Molecular Formula | C14H27N2O3P |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N'-[[trimethoxy(2-phenylethyl)-λ5-phosphanyl]methyl]ethane-1,2-diamine |
| SMILES | COP(CCc1ccccc1)(CNCCN)(OC)OC |
| InChI | InChI=1S/C14H27N2O3P/c1-17-20(18-2,19-3,13-16-11-10-15)12-9-14-7-5-4-6-8-14/h4-8,16H,9-13,15H2,1-3H3 |
| InChIKey | WSPHQQJHDIWAFP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|