C9H3BrF3N3O3S — CID 164847379
(6-bromo-3-isocyanopyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate (PubChem CID 164847379) has the molecular formula C9H3BrF3N3O3S and a molecular weight of 370.11 g/mol. Its IUPAC name is (6-bromo-3-isocyanopyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate.
| Compound Name | (6-bromo-3-isocyanopyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 164847379 |
| Molecular Formula | C9H3BrF3N3O3S |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 368.90 |
| IUPAC Name | (6-bromo-3-isocyanopyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate |
| SMILES | [C-]#[N+]c1cnn2cc(Br)cc(OS(=O)(=O)C(F)(F)F)c12 |
| InChI | InChI=1S/C9H3BrF3N3O3S/c1-14-6-3-15-16-4-5(10)2-7(8(6)16)19-20(17,18)9(11,12)13/h2-4H |
| InChIKey | UUSIVRXNEUCWJO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|