C16H19F3N2O4 — CID 164856476
(E)-1-(1,4-dioxan-2-ylmethoxy)-3-imino-3-[4-(2,2,2-trifluoroethoxy)phenyl]prop-1-en-1-amine (PubChem CID 164856476) has the molecular formula C16H19F3N2O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is (E)-1-(1,4-dioxan-2-ylmethoxy)-3-imino-3-[4-(2,2,2-trifluoroethoxy)phenyl]prop-1-en-1-amine.
| Compound Name | (E)-1-(1,4-dioxan-2-ylmethoxy)-3-imino-3-[4-(2,2,2-trifluoroethoxy)phenyl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 164856476 |
| Molecular Formula | C16H19F3N2O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (E)-1-(1,4-dioxan-2-ylmethoxy)-3-imino-3-[4-(2,2,2-trifluoroethoxy)phenyl]prop-1-en-1-amine |
| SMILES | [H]/N=C(\C=C(/N)OCC1COCCO1)c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3N2O4/c17-16(18,19)10-25-12-3-1-11(2-4-12)14(20)7-15(21)24-9-13-8-22-5-6-23-13/h1-4,7,13,20H,5-6,8-10,21H2/b15-7+,20-14+ |
| InChIKey | ZQOWGPPOALOYRO-UTNPLVRFSA-N |
| XLogP | 2.23 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|