C24H26F2O5 — CID 164856575
2-[[3-[4-(2,2-difluorobut-3-enoxy)phenyl]-5-(oxetan-3-yl)phenoxy]methyl]-1,4-dioxane (PubChem CID 164856575) has the molecular formula C24H26F2O5 and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-[[3-[4-(2,2-difluorobut-3-enoxy)phenyl]-5-(oxetan-3-yl)phenoxy]methyl]-1,4-dioxane.
| Compound Name | 2-[[3-[4-(2,2-difluorobut-3-enoxy)phenyl]-5-(oxetan-3-yl)phenoxy]methyl]-1,4-dioxane |
|---|---|
| PubChem CID | 164856575 |
| Molecular Formula | C24H26F2O5 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-[[3-[4-(2,2-difluorobut-3-enoxy)phenyl]-5-(oxetan-3-yl)phenoxy]methyl]-1,4-dioxane |
| SMILES | C=CC(F)(F)COc1ccc(-c2cc(OCC3COCCO3)cc(C3COC3)c2)cc1 |
| InChI | InChI=1S/C24H26F2O5/c1-2-24(25,26)16-31-21-5-3-17(4-6-21)18-9-19(20-12-28-13-20)11-22(10-18)30-15-23-14-27-7-8-29-23/h2-6,9-11,20,23H,1,7-8,12-16H2 |
| InChIKey | HZRHXLAZDDJVHY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|