C18H21F2N3O — CID 164856668
(2E)-3-[5-(2-cyclopropylethynyl)-2-methylphenyl]-3-(2,2-difluoropropoxy)-2-hydrazinylidenepropan-1-imine (PubChem CID 164856668) has the molecular formula C18H21F2N3O and a molecular weight of 333.38 g/mol. Its IUPAC name is (2E)-3-[5-(2-cyclopropylethynyl)-2-methylphenyl]-3-(2,2-difluoropropoxy)-2-hydrazinylidenepropan-1-imine.
| Compound Name | (2E)-3-[5-(2-cyclopropylethynyl)-2-methylphenyl]-3-(2,2-difluoropropoxy)-2-hydrazinylidenepropan-1-imine |
|---|---|
| PubChem CID | 164856668 |
| Molecular Formula | C18H21F2N3O |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (2E)-3-[5-(2-cyclopropylethynyl)-2-methylphenyl]-3-(2,2-difluoropropoxy)-2-hydrazinylidenepropan-1-imine |
| SMILES | [H]/N=C/C(=N\N)C(OCC(C)(F)F)c1cc(C#CC2CC2)ccc1C |
| InChI | InChI=1S/C18H21F2N3O/c1-12-3-4-14(8-7-13-5-6-13)9-15(12)17(16(10-21)23-22)24-11-18(2,19)20/h3-4,9-10,13,17,21H,5-6,11,22H2,1-2H3/b21-10+,23-16+ |
| InChIKey | DENLEAFRJNMXST-QNOFZJFZSA-N |
| XLogP | 3.43 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|