C28H39N7O2 — CID 164857234
(Z)-1-[5-[3-[amino-[(Z)-2-amino-2-[4-(dimethylamino)phenyl]ethenyl]amino]prop-1-ynyl]-3-methyl-2-pyridinyl]-N'-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]ethene-1,2-diamine (PubChem CID 164857234) has the molecular formula C28H39N7O2 and a molecular weight of 505.67 g/mol. Its IUPAC name is (Z)-1-[5-[3-[amino-[(Z)-2-amino-2-[4-(dimethylamino)phenyl]ethenyl]amino]prop-1-ynyl]-3-methyl-2-pyridinyl]-N'-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]ethene-1,2-diamine.
| Compound Name | (Z)-1-[5-[3-[amino-[(Z)-2-amino-2-[4-(dimethylamino)phenyl]ethenyl]amino]prop-1-ynyl]-3-methyl-2-pyridinyl]-N'-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]ethene-1,2-diamine |
|---|---|
| PubChem CID | 164857234 |
| Molecular Formula | C28H39N7O2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | (Z)-1-[5-[3-[amino-[(Z)-2-amino-2-[4-(dimethylamino)phenyl]ethenyl]amino]prop-1-ynyl]-3-methyl-2-pyridinyl]-N'-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]ethene-1,2-diamine |
| SMILES | Cc1cc(C#CCN(N)/C=C(\N)c2ccc(N(C)C)cc2)cnc1/C(N)=C/NCC1OCC(C)(C)CO1 |
| InChI | InChI=1S/C28H39N7O2/c1-20-13-21(7-6-12-35(31)17-25(30)22-8-10-23(11-9-22)34(4)5)14-33-27(20)24(29)15-32-16-26-36-18-28(2,3)19-37-26/h8-11,13-15,17,26,32H,12,16,18-19,29-31H2,1-5H3/b24-15-,25-17- |
| InChIKey | MXHLGSCPVKKDEA-ZHSFSFBBSA-N |
| XLogP | 2.19 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|