About 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine
3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine (PubChem CID 164858543) has the molecular formula C17H23N3O2
and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine.
Molecular Properties
| Compound Name | 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine |
| PubChem CID | 164858543 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine |
| SMILES | NCC1COCCO1.[H]/N=C(\N)c1cccc(C#CC2CC2)c1 |
| InChI | InChI=1S/C12H12N2.C5H11NO2/c13-12(14)11-3-1-2-10(8-11)7-6-9-4-5-9;6-3-5-4-7-1-2-8-5/h1-3,8-9H,4-5H2,(H3,13,14);5H,1-4,6H2 |
| InChIKey | KHZYKNLMIBOIBO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine?
The IUPAC name of 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine (CID 164858543) is 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine.
What is the SMILES notation for 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine?
The canonical SMILES for 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine is NCC1COCCO1.[H]/N=C(\N)c1cccc(C#CC2CC2)c1.
What is the InChIKey of 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine?
The InChIKey is KHZYKNLMIBOIBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C5H11NO2/c13-12(14)11-3-1-2-10(8-11)7-6-9-4-5-9;6-3-5-4-7-1-2-8-5/h1-3,8-9H,4-5H2,(H3,13,14);5H,1-4,6H2.
What are the key properties of 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine?
3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine has a molecular weight of 301.39 g/mol, XLogP of 1.09, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine is sourced from PubChem (CID 164858543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).