C17H23N3O2 — CID 164858543
3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine (PubChem CID 164858543) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine.
| Compound Name | 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine |
|---|---|
| PubChem CID | 164858543 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 3-(2-cyclopropylethynyl)benzenecarboximidamide;1,4-dioxan-2-ylmethanamine |
| SMILES | NCC1COCCO1.[H]/N=C(\N)c1cccc(C#CC2CC2)c1 |
| InChI | InChI=1S/C12H12N2.C5H11NO2/c13-12(14)11-3-1-2-10(8-11)7-6-9-4-5-9;6-3-5-4-7-1-2-8-5/h1-3,8-9H,4-5H2,(H3,13,14);5H,1-4,6H2 |
| InChIKey | KHZYKNLMIBOIBO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|