C22H23ClN2O3S — CID 164861964
N-[4-[(1S)-1-(4-chlorophenyl)-2-(dimethylamino)ethyl]phenoxy]benzenesulfonamide (PubChem CID 164861964) has the molecular formula C22H23ClN2O3S and a molecular weight of 430.96 g/mol. Its IUPAC name is N-[4-[(1S)-1-(4-chlorophenyl)-2-(dimethylamino)ethyl]phenoxy]benzenesulfonamide.
| Compound Name | N-[4-[(1S)-1-(4-chlorophenyl)-2-(dimethylamino)ethyl]phenoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 164861964 |
| Molecular Formula | C22H23ClN2O3S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-[4-[(1S)-1-(4-chlorophenyl)-2-(dimethylamino)ethyl]phenoxy]benzenesulfonamide |
| SMILES | CN(C)C[C@H](c1ccc(Cl)cc1)c1ccc(ONS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23ClN2O3S/c1-25(2)16-22(17-8-12-19(23)13-9-17)18-10-14-20(15-11-18)28-24-29(26,27)21-6-4-3-5-7-21/h3-15,22,24H,16H2,1-2H3/t22-/m1/s1 |
| InChIKey | GPWUEJBIDSYNIF-JOCHJYFZSA-N |
| XLogP | 4.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|