C25H27Cl2N3O3S — CID 164861852
N-[4-[1-(3,4-dichlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]phenoxy]benzenesulfonamide (PubChem CID 164861852) has the molecular formula C25H27Cl2N3O3S and a molecular weight of 520.48 g/mol. Its IUPAC name is N-[4-[1-(3,4-dichlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]phenoxy]benzenesulfonamide.
| Compound Name | N-[4-[1-(3,4-dichlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]phenoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 164861852 |
| Molecular Formula | C25H27Cl2N3O3S |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | N-[4-[1-(3,4-dichlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]phenoxy]benzenesulfonamide |
| SMILES | CN1CCN(CC(c2ccc(ONS(=O)(=O)c3ccccc3)cc2)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C25H27Cl2N3O3S/c1-29-13-15-30(16-14-29)18-23(20-9-12-24(26)25(27)17-20)19-7-10-21(11-8-19)33-28-34(31,32)22-5-3-2-4-6-22/h2-12,17,23,28H,13-16,18H2,1H3 |
| InChIKey | BMNAPQHZPKBEJA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|