C15H18FNO2 — CID 164868429
methyl (3R,10bS)-10-fluoro-3-methyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline-8-carboxylate (PubChem CID 164868429) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is methyl (3R,10bS)-10-fluoro-3-methyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline-8-carboxylate.
| Compound Name | methyl (3R,10bS)-10-fluoro-3-methyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline-8-carboxylate |
|---|---|
| PubChem CID | 164868429 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | methyl (3R,10bS)-10-fluoro-3-methyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline-8-carboxylate |
| SMILES | COC(=O)c1cc(F)c2c(c1)CCN1[C@H](C)CC[C@@H]21 |
| InChI | InChI=1S/C15H18FNO2/c1-9-3-4-13-14-10(5-6-17(9)13)7-11(8-12(14)16)15(18)19-2/h7-9,13H,3-6H2,1-2H3/t9-,13+/m1/s1 |
| InChIKey | UOPWSEIWUCNXIJ-RNCFNFMXSA-N |
| XLogP | 2.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |