C15H19FN2O2 — CID 164868790
(2R,3R,10bS)-10-fluoro-N-hydroxy-2,3-dimethyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline-8-carboxamide (PubChem CID 164868790) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is (2R,3R,10bS)-10-fluoro-N-hydroxy-2,3-dimethyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline-8-carboxamide.
| Compound Name | (2R,3R,10bS)-10-fluoro-N-hydroxy-2,3-dimethyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 164868790 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (2R,3R,10bS)-10-fluoro-N-hydroxy-2,3-dimethyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline-8-carboxamide |
| SMILES | C[C@@H]1C[C@H]2c3c(F)cc(C(=O)NO)cc3CCN2[C@@H]1C |
| InChI | InChI=1S/C15H19FN2O2/c1-8-5-13-14-10(3-4-18(13)9(8)2)6-11(7-12(14)16)15(19)17-20/h6-9,13,20H,3-5H2,1-2H3,(H,17,19)/t8-,9-,13+/m1/s1 |
| InChIKey | DPFFADUMXUDCFB-KKFJDGPESA-N |
| XLogP | 2.27 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|