C13H14FN2O2Si — CID 164868362
CID 164868362 (PubChem CID 164868362) has the molecular formula C13H14FN2O2Si and a molecular weight of 277.35 g/mol.
| Compound Name | CID 164868362 |
|---|---|
| PubChem CID | 164868362 |
| Molecular Formula | C13H14FN2O2Si |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | — |
| SMILES | C[C@]1([Si])C[C@@H]2c3c(F)cc(C(=O)NO)cc3CN2C1 |
| InChI | InChI=1S/C13H14FN2O2Si/c1-13(19)4-10-11-8(5-16(10)6-13)2-7(3-9(11)14)12(17)15-18/h2-3,10,18H,4-6H2,1H3,(H,15,17)/t10-,13+/m1/s1 |
| InChIKey | UUHRPTRXAMBBCT-MFKMUULPSA-N |
| XLogP | 1.55 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|