C14H17FN2O3 — CID 164868746
(11aR)-7-fluoro-N-hydroxy-11a-methyl-3,4,6,11-tetrahydro-1H-[1,4]oxazino[4,3-b]isoquinoline-9-carboxamide (PubChem CID 164868746) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is (11aR)-7-fluoro-N-hydroxy-11a-methyl-3,4,6,11-tetrahydro-1H-[1,4]oxazino[4,3-b]isoquinoline-9-carboxamide.
| Compound Name | (11aR)-7-fluoro-N-hydroxy-11a-methyl-3,4,6,11-tetrahydro-1H-[1,4]oxazino[4,3-b]isoquinoline-9-carboxamide |
|---|---|
| PubChem CID | 164868746 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (11aR)-7-fluoro-N-hydroxy-11a-methyl-3,4,6,11-tetrahydro-1H-[1,4]oxazino[4,3-b]isoquinoline-9-carboxamide |
| SMILES | C[C@@]12COCCN1Cc1c(F)cc(C(=O)NO)cc1C2 |
| InChI | InChI=1S/C14H17FN2O3/c1-14-6-10-4-9(13(18)16-19)5-12(15)11(10)7-17(14)2-3-20-8-14/h4-5,19H,2-3,6-8H2,1H3,(H,16,18)/t14-/m1/s1 |
| InChIKey | WILXVGIEQPMVNP-CQSZACIVSA-N |
| XLogP | 1.09 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|