C16H22FN7S — CID 164879176
3-[4-(3,5-dimethyl-1,2-thiazol-4-yl)piperazin-1-yl]-4-fluoro-N'-hydrazinylbenzenecarboximidamide (PubChem CID 164879176) has the molecular formula C16H22FN7S and a molecular weight of 363.47 g/mol. Its IUPAC name is 3-[4-(3,5-dimethyl-1,2-thiazol-4-yl)piperazin-1-yl]-4-fluoro-N'-hydrazinylbenzenecarboximidamide.
| Compound Name | 3-[4-(3,5-dimethyl-1,2-thiazol-4-yl)piperazin-1-yl]-4-fluoro-N'-hydrazinylbenzenecarboximidamide |
|---|---|
| PubChem CID | 164879176 |
| Molecular Formula | C16H22FN7S |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-[4-(3,5-dimethyl-1,2-thiazol-4-yl)piperazin-1-yl]-4-fluoro-N'-hydrazinylbenzenecarboximidamide |
| SMILES | Cc1nsc(C)c1N1CCN(c2cc(/C(N)=N/NN)ccc2F)CC1 |
| InChI | InChI=1S/C16H22FN7S/c1-10-15(11(2)25-21-10)24-7-5-23(6-8-24)14-9-12(3-4-13(14)17)16(18)20-22-19/h3-4,9,22H,5-8,19H2,1-2H3,(H2,18,20) |
| InChIKey | RSXORIYCDADQDN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|