C36H48N4O3Si — CID 164880035
N-[1-tert-butyl-3-[4-[tert-butyl(diphenyl)silyl]oxycycloheptyl]pyrazol-5-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 164880035) has the molecular formula C36H48N4O3Si and a molecular weight of 612.89 g/mol. Its IUPAC name is N-[1-tert-butyl-3-[4-[tert-butyl(diphenyl)silyl]oxycycloheptyl]pyrazol-5-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide.
| Compound Name | N-[1-tert-butyl-3-[4-[tert-butyl(diphenyl)silyl]oxycycloheptyl]pyrazol-5-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 164880035 |
| Molecular Formula | C36H48N4O3Si |
| Molecular Weight | 612.89 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | N-[1-tert-butyl-3-[4-[tert-butyl(diphenyl)silyl]oxycycloheptyl]pyrazol-5-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | Cc1cc(CC(=O)Nc2cc(C3CCCC(O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)CC3)nn2C(C)(C)C)on1 |
| InChI | InChI=1S/C36H48N4O3Si/c1-26-23-29(42-39-26)24-34(41)37-33-25-32(38-40(33)35(2,3)4)27-15-14-16-28(22-21-27)43-44(36(5,6)7,30-17-10-8-11-18-30)31-19-12-9-13-20-31/h8-13,17-20,23,25,27-28H,14-16,21-22,24H2,1-7H3,(H,37,41) |
| InChIKey | KIKLAXQVFFWJQS-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.89 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|