C29H35N5O3Si — CID 164879735
N-[1-[(1S,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclopentyl]-1,2,4-triazol-3-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 164879735) has the molecular formula C29H35N5O3Si and a molecular weight of 529.72 g/mol. Its IUPAC name is N-[1-[(1S,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclopentyl]-1,2,4-triazol-3-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide.
| Compound Name | N-[1-[(1S,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclopentyl]-1,2,4-triazol-3-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 164879735 |
| Molecular Formula | C29H35N5O3Si |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | N-[1-[(1S,3R)-3-[tert-butyl(diphenyl)silyl]oxycyclopentyl]-1,2,4-triazol-3-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | Cc1cc(CC(=O)Nc2ncn([C@H]3CC[C@@H](O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C3)n2)on1 |
| InChI | InChI=1S/C29H35N5O3Si/c1-21-17-24(36-33-21)19-27(35)31-28-30-20-34(32-28)22-15-16-23(18-22)37-38(29(2,3)4,25-11-7-5-8-12-25)26-13-9-6-10-14-26/h5-14,17,20,22-23H,15-16,18-19H2,1-4H3,(H,31,32,35)/t22-,23+/m0/s1 |
| InChIKey | QXDUTPKFZLXIJE-XZOQPEGZSA-N |
| XLogP | 4.43 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|